| Name | Xanthylium, 3,6-bis(ethylamino)-9-[2-(methoxycarbonyl)phenyl]-2,7-dimethyl-, molybdatesilicate |
| Synonyms | Rhdamine Lake(MSA) methyl 2-[3,6-bis(ethylamino)-2,7-dimethyl-1H-xanthen-9-yl]benzoate 3,6-Bis(ethylamino)-9-(2-(methoxycarbonyl)phenyl)-2,7-dimethylxanthylium molybdatesilicate 9-[2-(methoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-Xanthylium,molybdatesilicate Xanthylium, 3,6-bis(ethylamino)-9-[2-(methoxycarbonyl)phenyl]-2,7-dimethyl-, molybdatesilicate Benzoic acid,2-[6-(ethylamino)-3-(ethylimino)-2,7-dimethyl-3H-xanthen-9-yl]-,methyl ester,molybdosilicate Xanthylium, 3,6-bis(ethylamino)-9-[2-(methoxycarbonyl)phenyl]-2,7-dimethyl-, molybdatesilicatelybdatesilicate |
| CAS | 75627-12-2 |
| EINECS | 278-270-6 |
| InChI | InChI=1/C27H30N2O3/c1-6-28-22-14-24-20(12-16(22)3)26(18-10-8-9-11-19(18)27(30)31-5)21-13-17(4)23(29-7-2)15-25(21)32-24/h8-12,14-15,28-29H,6-7,13H2,1-5H3 |
| Molecular Formula | C108H116MoN8O19Si |
| Molar Mass | 1954.14434 |
| Density | 1.82g/cm3 at 20℃ |
| Boling Point | 608.7°C at 760 mmHg |
| Flash Point | 321.9°C |
| Vapor Presure | 0-0Pa at 20-25℃ |
| Appearance | Solid:particulate/powder |
| Refractive Index | 1.622 |
| Physical and Chemical Properties | hue or color light: brilliant blue, light red |
| Use | The pigment is a molybdenum silicate type Lake, which gives blue red, conforms to magenta for four-color plate overprinting printing ink, and has high coloring power. It is mainly used for printing ink coloring, such as NC-type solvent printing ink and cultural materials coloring. |
| LogP | 4.1-5.7 at 20℃ |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |